About methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate
methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate (PubChem CID 11744877) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate.
Molecular Properties
| Compound Name | methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate |
| PubChem CID | 11744877 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate |
| SMILES | COC(=O)C1(C)CCC=[N+]1[O-] |
| InChI | InChI=1S/C7H11NO3/c1-7(6(9)11-2)4-3-5-8(7)10/h5H,3-4H2,1-2H3 |
| InChIKey | DYRWHKZXMWAOQB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
The IUPAC name of methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate (CID 11744877) is methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate.
What is the SMILES notation for methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
The canonical SMILES for methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate is COC(=O)C1(C)CCC=[N+]1[O-].
What is the InChIKey of methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
The InChIKey is DYRWHKZXMWAOQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-7(6(9)11-2)4-3-5-8(7)10/h5H,3-4H2,1-2H3.
What are the key properties of methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate has a molecular weight of 157.17 g/mol, XLogP of 0.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate is sourced from PubChem (CID 11744877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).