About (4R)-1,1-difluorooct-2-yn-4-ol
(4R)-1,1-difluorooct-2-yn-4-ol (PubChem CID 11744945) has the molecular formula C8H12F2O
and a molecular weight of 162.18 g/mol. Its IUPAC name is (4R)-1,1-difluorooct-2-yn-4-ol.
Molecular Properties
| Compound Name | (4R)-1,1-difluorooct-2-yn-4-ol |
| PubChem CID | 11744945 |
| Molecular Formula | C8H12F2O |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (4R)-1,1-difluorooct-2-yn-4-ol |
| SMILES | CCCC[C@@H](O)C#CC(F)F |
| InChI | InChI=1S/C8H12F2O/c1-2-3-4-7(11)5-6-8(9)10/h7-8,11H,2-4H2,1H3/t7-/m1/s1 |
| InChIKey | ABEJCCWEUYTUTL-SSDOTTSWSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-1,1-difluorooct-2-yn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1,1-difluorooct-2-yn-4-ol?
The IUPAC name of (4R)-1,1-difluorooct-2-yn-4-ol (CID 11744945) is (4R)-1,1-difluorooct-2-yn-4-ol.
What is the SMILES notation for (4R)-1,1-difluorooct-2-yn-4-ol?
The canonical SMILES for (4R)-1,1-difluorooct-2-yn-4-ol is CCCC[C@@H](O)C#CC(F)F.
What is the InChIKey of (4R)-1,1-difluorooct-2-yn-4-ol?
The InChIKey is ABEJCCWEUYTUTL-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H12F2O/c1-2-3-4-7(11)5-6-8(9)10/h7-8,11H,2-4H2,1H3/t7-/m1/s1.
What are the key properties of (4R)-1,1-difluorooct-2-yn-4-ol?
(4R)-1,1-difluorooct-2-yn-4-ol has a molecular weight of 162.18 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1,1-difluorooct-2-yn-4-ol is sourced from PubChem (CID 11744945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).