About 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine
4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine (PubChem CID 117449862) has the molecular formula C12H12N2O4S
and a molecular weight of 280.31 g/mol. Its IUPAC name is 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine |
| PubChem CID | 117449862 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine |
| SMILES | Nc1oncc1-c1ccc(OC2CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C12H12N2O4S/c13-12-11(5-14-18-12)8-1-3-9(4-2-8)17-10-6-19(15,16)7-10/h1-5,10H,6-7,13H2 |
| InChIKey | SVAKQRMCPXSERI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine?
The IUPAC name of 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine (CID 117449862) is 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine.
What is the SMILES notation for 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine?
The canonical SMILES for 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine is Nc1oncc1-c1ccc(OC2CS(=O)(=O)C2)cc1.
What is the InChIKey of 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine?
The InChIKey is SVAKQRMCPXSERI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4S/c13-12-11(5-14-18-12)8-1-3-9(4-2-8)17-10-6-19(15,16)7-10/h1-5,10H,6-7,13H2.
What are the key properties of 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine?
4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine has a molecular weight of 280.31 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1,1-dioxothietan-3-yl)oxyphenyl]-1,2-oxazol-5-amine is sourced from PubChem (CID 117449862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).