About 1,4-benzoxathiin-2-one
1,4-benzoxathiin-2-one (PubChem CID 11744995) has the molecular formula C8H6O2S
and a molecular weight of 166.20 g/mol. Its IUPAC name is 1,4-benzoxathiin-2-one.
Molecular Properties
| Compound Name | 1,4-benzoxathiin-2-one |
| PubChem CID | 11744995 |
| Molecular Formula | C8H6O2S |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 1,4-benzoxathiin-2-one |
| SMILES | O=C1CSc2ccccc2O1 |
| InChI | InChI=1S/C8H6O2S/c9-8-5-11-7-4-2-1-3-6(7)10-8/h1-4H,5H2 |
| InChIKey | DEBYVIFQIVMNGL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1,4-benzoxathiin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-benzoxathiin-2-one?
The IUPAC name of 1,4-benzoxathiin-2-one (CID 11744995) is 1,4-benzoxathiin-2-one.
What is the SMILES notation for 1,4-benzoxathiin-2-one?
The canonical SMILES for 1,4-benzoxathiin-2-one is O=C1CSc2ccccc2O1.
What is the InChIKey of 1,4-benzoxathiin-2-one?
The InChIKey is DEBYVIFQIVMNGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2S/c9-8-5-11-7-4-2-1-3-6(7)10-8/h1-4H,5H2.
What are the key properties of 1,4-benzoxathiin-2-one?
1,4-benzoxathiin-2-one has a molecular weight of 166.20 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-benzoxathiin-2-one is sourced from PubChem (CID 11744995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).