About methyl 2-phenylmethoxyacetate
methyl 2-phenylmethoxyacetate (PubChem CID 11745225) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is methyl 2-phenylmethoxyacetate.
Molecular Properties
| Compound Name | methyl 2-phenylmethoxyacetate |
| PubChem CID | 11745225 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | methyl 2-phenylmethoxyacetate |
| SMILES | COC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C10H12O3/c1-12-10(11)8-13-7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | QNEIZSSWCVSZOS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-phenylmethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-phenylmethoxyacetate?
The IUPAC name of methyl 2-phenylmethoxyacetate (CID 11745225) is methyl 2-phenylmethoxyacetate.
What is the SMILES notation for methyl 2-phenylmethoxyacetate?
The canonical SMILES for methyl 2-phenylmethoxyacetate is COC(=O)COCc1ccccc1.
What is the InChIKey of methyl 2-phenylmethoxyacetate?
The InChIKey is QNEIZSSWCVSZOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-12-10(11)8-13-7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3.
What are the key properties of methyl 2-phenylmethoxyacetate?
methyl 2-phenylmethoxyacetate has a molecular weight of 180.20 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-phenylmethoxyacetate is sourced from PubChem (CID 11745225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).