About butylsulfinylbenzene
butylsulfinylbenzene (PubChem CID 11745267) has the molecular formula C10H14OS
and a molecular weight of 182.29 g/mol. Its IUPAC name is butylsulfinylbenzene.
Molecular Properties
| Compound Name | butylsulfinylbenzene |
| PubChem CID | 11745267 |
| Molecular Formula | C10H14OS |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | butylsulfinylbenzene |
| SMILES | CCCCS(=O)c1ccccc1 |
| InChI | InChI=1S/C10H14OS/c1-2-3-9-12(11)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3 |
| InChIKey | IMRHEMHQODDESO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butylsulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylsulfinylbenzene?
The IUPAC name of butylsulfinylbenzene (CID 11745267) is butylsulfinylbenzene.
What is the SMILES notation for butylsulfinylbenzene?
The canonical SMILES for butylsulfinylbenzene is CCCCS(=O)c1ccccc1.
What is the InChIKey of butylsulfinylbenzene?
The InChIKey is IMRHEMHQODDESO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14OS/c1-2-3-9-12(11)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3.
What are the key properties of butylsulfinylbenzene?
butylsulfinylbenzene has a molecular weight of 182.29 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butylsulfinylbenzene is sourced from PubChem (CID 11745267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).