About methyl (3S)-3,7-dimethyloct-6-enoate
methyl (3S)-3,7-dimethyloct-6-enoate (PubChem CID 11745305) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is methyl (3S)-3,7-dimethyloct-6-enoate.
Molecular Properties
| Compound Name | methyl (3S)-3,7-dimethyloct-6-enoate |
| PubChem CID | 11745305 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | methyl (3S)-3,7-dimethyloct-6-enoate |
| SMILES | COC(=O)C[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C11H20O2/c1-9(2)6-5-7-10(3)8-11(12)13-4/h6,10H,5,7-8H2,1-4H3/t10-/m0/s1 |
| InChIKey | ZFLPOPCZMXGUOJ-JTQLQIEISA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (3S)-3,7-dimethyloct-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3,7-dimethyloct-6-enoate?
The IUPAC name of methyl (3S)-3,7-dimethyloct-6-enoate (CID 11745305) is methyl (3S)-3,7-dimethyloct-6-enoate.
What is the SMILES notation for methyl (3S)-3,7-dimethyloct-6-enoate?
The canonical SMILES for methyl (3S)-3,7-dimethyloct-6-enoate is COC(=O)C[C@@H](C)CCC=C(C)C.
What is the InChIKey of methyl (3S)-3,7-dimethyloct-6-enoate?
The InChIKey is ZFLPOPCZMXGUOJ-JTQLQIEISA-N. The full InChI is InChI=1S/C11H20O2/c1-9(2)6-5-7-10(3)8-11(12)13-4/h6,10H,5,7-8H2,1-4H3/t10-/m0/s1.
What are the key properties of methyl (3S)-3,7-dimethyloct-6-enoate?
methyl (3S)-3,7-dimethyloct-6-enoate has a molecular weight of 184.28 g/mol, XLogP of 2.93, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3,7-dimethyloct-6-enoate is sourced from PubChem (CID 11745305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).