About 4-heptan-2-ylmorpholine
4-heptan-2-ylmorpholine (PubChem CID 11745328) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 4-heptan-2-ylmorpholine.
Molecular Properties
| Compound Name | 4-heptan-2-ylmorpholine |
| PubChem CID | 11745328 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 4-heptan-2-ylmorpholine |
| SMILES | CCCCCC(C)N1CCOCC1 |
| InChI | InChI=1S/C11H23NO/c1-3-4-5-6-11(2)12-7-9-13-10-8-12/h11H,3-10H2,1-2H3 |
| InChIKey | NKXCMWIVSOTHOV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-heptan-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptan-2-ylmorpholine?
The IUPAC name of 4-heptan-2-ylmorpholine (CID 11745328) is 4-heptan-2-ylmorpholine.
What is the SMILES notation for 4-heptan-2-ylmorpholine?
The canonical SMILES for 4-heptan-2-ylmorpholine is CCCCCC(C)N1CCOCC1.
What is the InChIKey of 4-heptan-2-ylmorpholine?
The InChIKey is NKXCMWIVSOTHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-3-4-5-6-11(2)12-7-9-13-10-8-12/h11H,3-10H2,1-2H3.
What are the key properties of 4-heptan-2-ylmorpholine?
4-heptan-2-ylmorpholine has a molecular weight of 185.31 g/mol, XLogP of 2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptan-2-ylmorpholine is sourced from PubChem (CID 11745328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).