C14H20BrN — CID 117453302
1-(5-bromo-2,3-dimethylphenyl)cyclohexan-1-amine (PubChem CID 117453302) has the molecular formula C14H20BrN and a molecular weight of 282.22 g/mol. Its IUPAC name is 1-(5-bromo-2,3-dimethylphenyl)cyclohexan-1-amine.
| Compound Name | 1-(5-bromo-2,3-dimethylphenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 117453302 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-(5-bromo-2,3-dimethylphenyl)cyclohexan-1-amine |
| SMILES | Cc1cc(Br)cc(C2(N)CCCCC2)c1C |
| InChI | InChI=1S/C14H20BrN/c1-10-8-12(15)9-13(11(10)2)14(16)6-4-3-5-7-14/h8-9H,3-7,16H2,1-2H3 |
| InChIKey | KBJQXJWYFNWBSA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |