C11H17NO2 — CID 11745553
(3S,3aS,7aR)-3-(hydroxymethyl)-5,6-dimethyl-2,3,3a,4,7,7a-hexahydroisoindol-1-one (PubChem CID 11745553) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (3S,3aS,7aR)-3-(hydroxymethyl)-5,6-dimethyl-2,3,3a,4,7,7a-hexahydroisoindol-1-one.
| Compound Name | (3S,3aS,7aR)-3-(hydroxymethyl)-5,6-dimethyl-2,3,3a,4,7,7a-hexahydroisoindol-1-one |
|---|---|
| PubChem CID | 11745553 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (3S,3aS,7aR)-3-(hydroxymethyl)-5,6-dimethyl-2,3,3a,4,7,7a-hexahydroisoindol-1-one |
| SMILES | CC1=C(C)C[C@H]2C(=O)N[C@H](CO)[C@H]2C1 |
| InChI | InChI=1S/C11H17NO2/c1-6-3-8-9(4-7(6)2)11(14)12-10(8)5-13/h8-10,13H,3-5H2,1-2H3,(H,12,14)/t8-,9+,10+/m0/s1 |
| InChIKey | GVOJNIXCAHWETQ-IVZWLZJFSA-N |
| XLogP | 0.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|