C10H17BO3 — CID 11745556
(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-one (PubChem CID 11745556) has the molecular formula C10H17BO3 and a molecular weight of 196.06 g/mol. Its IUPAC name is (E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-one.
| Compound Name | (E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 11745556 |
| Molecular Formula | C10H17BO3 |
| Molecular Weight | 196.06 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H17BO3/c1-8(12)6-7-11-13-9(2,3)10(4,5)14-11/h6-7H,1-5H3/b7-6+ |
| InChIKey | JXORKYUYGAUCBT-VOTSOKGWSA-N |
| XLogP | 1.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.06 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|