About (E)-3,7-dimethyloct-2-enedioic acid
(E)-3,7-dimethyloct-2-enedioic acid (PubChem CID 11745660) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is (E)-3,7-dimethyloct-2-enedioic acid.
Molecular Properties
| Compound Name | (E)-3,7-dimethyloct-2-enedioic acid |
| PubChem CID | 11745660 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (E)-3,7-dimethyloct-2-enedioic acid |
| SMILES | C/C(=C\C(=O)O)CCCC(C)C(=O)O |
| InChI | InChI=1S/C10H16O4/c1-7(6-9(11)12)4-3-5-8(2)10(13)14/h6,8H,3-5H2,1-2H3,(H,11,12)(H,13,14)/b7-6+ |
| InChIKey | VNSKHKIHRLWODC-VOTSOKGWSA-N |
| XLogP | 1.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,7-dimethyloct-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,7-dimethyloct-2-enedioic acid?
The IUPAC name of (E)-3,7-dimethyloct-2-enedioic acid (CID 11745660) is (E)-3,7-dimethyloct-2-enedioic acid.
What is the SMILES notation for (E)-3,7-dimethyloct-2-enedioic acid?
The canonical SMILES for (E)-3,7-dimethyloct-2-enedioic acid is C/C(=C\C(=O)O)CCCC(C)C(=O)O.
What is the InChIKey of (E)-3,7-dimethyloct-2-enedioic acid?
The InChIKey is VNSKHKIHRLWODC-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H16O4/c1-7(6-9(11)12)4-3-5-8(2)10(13)14/h6,8H,3-5H2,1-2H3,(H,11,12)(H,13,14)/b7-6+.
What are the key properties of (E)-3,7-dimethyloct-2-enedioic acid?
(E)-3,7-dimethyloct-2-enedioic acid has a molecular weight of 200.23 g/mol, XLogP of 1.91, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,7-dimethyloct-2-enedioic acid is sourced from PubChem (CID 11745660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).