C15H20N2O4S3 — CID 1174581
4-N,4-N-diethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide (PubChem CID 1174581) has the molecular formula C15H20N2O4S3 and a molecular weight of 388.54 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N,4-N-diethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 1174581 |
| Molecular Formula | C15H20N2O4S3 |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(S(=O)(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C15H20N2O4S3/c1-3-17(4-2)24(20,21)15-9-7-14(8-10-15)23(18,19)16-12-13-6-5-11-22-13/h5-11,16H,3-4,12H2,1-2H3 |
| InChIKey | JACIQMMTIXZHHF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |