C13H13ClO5 — CID 117458185
2-[6-chloro-2-(cyclopropylmethoxy)-3-methoxyphenyl]-2-oxoacetic acid (PubChem CID 117458185) has the molecular formula C13H13ClO5 and a molecular weight of 284.69 g/mol. Its IUPAC name is 2-[6-chloro-2-(cyclopropylmethoxy)-3-methoxyphenyl]-2-oxoacetic acid.
| Compound Name | 2-[6-chloro-2-(cyclopropylmethoxy)-3-methoxyphenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 117458185 |
| Molecular Formula | C13H13ClO5 |
| Molecular Weight | 284.69 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-[6-chloro-2-(cyclopropylmethoxy)-3-methoxyphenyl]-2-oxoacetic acid |
| SMILES | COc1ccc(Cl)c(C(=O)C(=O)O)c1OCC1CC1 |
| InChI | InChI=1S/C13H13ClO5/c1-18-9-5-4-8(14)10(11(15)13(16)17)12(9)19-6-7-2-3-7/h4-5,7H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | VLRAICGLZIKBTJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.69 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|