C14H21ClN2O2 — CID 117458546
4-chloro-2-methoxy-3,5-dimethyl-6-(piperazin-1-ylmethyl)phenol (PubChem CID 117458546) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 4-chloro-2-methoxy-3,5-dimethyl-6-(piperazin-1-ylmethyl)phenol.
| Compound Name | 4-chloro-2-methoxy-3,5-dimethyl-6-(piperazin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 117458546 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-chloro-2-methoxy-3,5-dimethyl-6-(piperazin-1-ylmethyl)phenol |
| SMILES | COc1c(C)c(Cl)c(C)c(CN2CCNCC2)c1O |
| InChI | InChI=1S/C14H21ClN2O2/c1-9-11(8-17-6-4-16-5-7-17)13(18)14(19-3)10(2)12(9)15/h16,18H,4-8H2,1-3H3 |
| InChIKey | FZZRGWNZCNXOAI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|