About [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate
[(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate (PubChem CID 11745897) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate.
Molecular Properties
| Compound Name | [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate |
| PubChem CID | 11745897 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate |
| SMILES | CC(=O)O/C=C/[C@@H]1C[C@H](C(C)=O)C1(C)C |
| InChI | InChI=1S/C12H18O3/c1-8(13)11-7-10(12(11,3)4)5-6-15-9(2)14/h5-6,10-11H,7H2,1-4H3/b6-5+/t10-,11-/m1/s1 |
| InChIKey | BBPDBYLTHFBSBB-XIJCSBCJSA-N |
| XLogP | 2.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate?
The IUPAC name of [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate (CID 11745897) is [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate.
What is the SMILES notation for [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate?
The canonical SMILES for [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate is CC(=O)O/C=C/[C@@H]1C[C@H](C(C)=O)C1(C)C.
What is the InChIKey of [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate?
The InChIKey is BBPDBYLTHFBSBB-XIJCSBCJSA-N. The full InChI is InChI=1S/C12H18O3/c1-8(13)11-7-10(12(11,3)4)5-6-15-9(2)14/h5-6,10-11H,7H2,1-4H3/b6-5+/t10-,11-/m1/s1.
What are the key properties of [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate?
[(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate has a molecular weight of 210.27 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-[(1S,3S)-3-acetyl-2,2-dimethylcyclobutyl]ethenyl] acetate is sourced from PubChem (CID 11745897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).