C13H17BrO2 — CID 117459003
3-(4-bromo-2-ethylphenyl)-3-methylbutanoic acid (PubChem CID 117459003) has the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. Its IUPAC name is 3-(4-bromo-2-ethylphenyl)-3-methylbutanoic acid.
| Compound Name | 3-(4-bromo-2-ethylphenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117459003 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-(4-bromo-2-ethylphenyl)-3-methylbutanoic acid |
| SMILES | CCc1cc(Br)ccc1C(C)(C)CC(=O)O |
| InChI | InChI=1S/C13H17BrO2/c1-4-9-7-10(14)5-6-11(9)13(2,3)8-12(15)16/h5-7H,4,8H2,1-3H3,(H,15,16) |
| InChIKey | JTIKWJOSJLWIFB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |