C13H19NO4S — CID 117459732
4-amino-4-(2,4-dimethoxy-3-methylsulfanylphenyl)butanoic acid (PubChem CID 117459732) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-amino-4-(2,4-dimethoxy-3-methylsulfanylphenyl)butanoic acid.
| Compound Name | 4-amino-4-(2,4-dimethoxy-3-methylsulfanylphenyl)butanoic acid |
|---|---|
| PubChem CID | 117459732 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-amino-4-(2,4-dimethoxy-3-methylsulfanylphenyl)butanoic acid |
| SMILES | COc1ccc(C(N)CCC(=O)O)c(OC)c1SC |
| InChI | InChI=1S/C13H19NO4S/c1-17-10-6-4-8(9(14)5-7-11(15)16)12(18-2)13(10)19-3/h4,6,9H,5,7,14H2,1-3H3,(H,15,16) |
| InChIKey | GCDODRQEORPCNY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |