C20H31N — CID 117460026
1-[2-(4,4-dimethylcyclohexyl)phenyl]cyclohexan-1-amine (PubChem CID 117460026) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is 1-[2-(4,4-dimethylcyclohexyl)phenyl]cyclohexan-1-amine.
| Compound Name | 1-[2-(4,4-dimethylcyclohexyl)phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 117460026 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 1-[2-(4,4-dimethylcyclohexyl)phenyl]cyclohexan-1-amine |
| SMILES | CC1(C)CCC(c2ccccc2C2(N)CCCCC2)CC1 |
| InChI | InChI=1S/C20H31N/c1-19(2)14-10-16(11-15-19)17-8-4-5-9-18(17)20(21)12-6-3-7-13-20/h4-5,8-9,16H,3,6-7,10-15,21H2,1-2H3 |
| InChIKey | KPGMROFAYDQBCM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |