C12H25NO2 — CID 11746013
(2S,3R)-4,4-dimethyl-1-[(2R)-piperidin-2-yl]pentane-2,3-diol (PubChem CID 11746013) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is (2S,3R)-4,4-dimethyl-1-[(2R)-piperidin-2-yl]pentane-2,3-diol.
| Compound Name | (2S,3R)-4,4-dimethyl-1-[(2R)-piperidin-2-yl]pentane-2,3-diol |
|---|---|
| PubChem CID | 11746013 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | (2S,3R)-4,4-dimethyl-1-[(2R)-piperidin-2-yl]pentane-2,3-diol |
| SMILES | CC(C)(C)[C@@H](O)[C@@H](O)C[C@H]1CCCCN1 |
| InChI | InChI=1S/C12H25NO2/c1-12(2,3)11(15)10(14)8-9-6-4-5-7-13-9/h9-11,13-15H,4-8H2,1-3H3/t9-,10+,11+/m1/s1 |
| InChIKey | JVGKSQIJZFARHN-VWYCJHECSA-N |
| XLogP | 1.29 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |