About [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride
[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride (PubChem CID 117462268) has the molecular formula C10H10ClF3O2S
and a molecular weight of 286.70 g/mol. Its IUPAC name is [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride.
Molecular Properties
| Compound Name | [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride |
| PubChem CID | 117462268 |
| Molecular Formula | C10H10ClF3O2S |
| Molecular Weight | 286.70 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride |
| SMILES | CC(C)(F)c1cc(F)c(F)c(CS(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C10H10ClF3O2S/c1-10(2,14)7-3-6(5-17(11,15)16)9(13)8(12)4-7/h3-4H,5H2,1-2H3 |
| InChIKey | PXYCTEGMQYWKAW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride?
The IUPAC name of [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride (CID 117462268) is [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride.
What is the SMILES notation for [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride?
The canonical SMILES for [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride is CC(C)(F)c1cc(F)c(F)c(CS(=O)(=O)Cl)c1.
What is the InChIKey of [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride?
The InChIKey is PXYCTEGMQYWKAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClF3O2S/c1-10(2,14)7-3-6(5-17(11,15)16)9(13)8(12)4-7/h3-4H,5H2,1-2H3.
What are the key properties of [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride?
[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride has a molecular weight of 286.70 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]methanesulfonyl chloride is sourced from PubChem (CID 117462268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).