C11H14O5 — CID 11746314
3,4-bis(methoxymethoxy)benzaldehyde (PubChem CID 11746314) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3,4-bis(methoxymethoxy)benzaldehyde.
| Compound Name | 3,4-bis(methoxymethoxy)benzaldehyde |
|---|---|
| PubChem CID | 11746314 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3,4-bis(methoxymethoxy)benzaldehyde |
| SMILES | COCOc1ccc(C=O)cc1OCOC |
| InChI | InChI=1S/C11H14O5/c1-13-7-15-10-4-3-9(6-12)5-11(10)16-8-14-2/h3-6H,7-8H2,1-2H3 |
| InChIKey | RYTSFSLVJDNOHI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|