C16H21N3O2 — CID 117463814
4-[4-[1-(aminomethyl)cyclobutyl]phenyl]-1-methylpiperazine-2,6-dione (PubChem CID 117463814) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[4-[1-(aminomethyl)cyclobutyl]phenyl]-1-methylpiperazine-2,6-dione.
| Compound Name | 4-[4-[1-(aminomethyl)cyclobutyl]phenyl]-1-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 117463814 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-[4-[1-(aminomethyl)cyclobutyl]phenyl]-1-methylpiperazine-2,6-dione |
| SMILES | CN1C(=O)CN(c2ccc(C3(CN)CCC3)cc2)CC1=O |
| InChI | InChI=1S/C16H21N3O2/c1-18-14(20)9-19(10-15(18)21)13-5-3-12(4-6-13)16(11-17)7-2-8-16/h3-6H,2,7-11,17H2,1H3 |
| InChIKey | BURLNKGHBGPCGT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|