About 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine
1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine (PubChem CID 117464678) has the molecular formula C11H11BrFNO2
and a molecular weight of 288.12 g/mol. Its IUPAC name is 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine |
| PubChem CID | 117464678 |
| Molecular Formula | C11H11BrFNO2 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine |
| SMILES | NC1(Cc2cc3c(c(Br)c2F)OCO3)CC1 |
| InChI | InChI=1S/C11H11BrFNO2/c12-8-9(13)6(4-11(14)1-2-11)3-7-10(8)16-5-15-7/h3H,1-2,4-5,14H2 |
| InChIKey | VWRQNXLCAOQHEH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine?
The IUPAC name of 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine (CID 117464678) is 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine.
What is the SMILES notation for 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine?
The canonical SMILES for 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine is NC1(Cc2cc3c(c(Br)c2F)OCO3)CC1.
What is the InChIKey of 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine?
The InChIKey is VWRQNXLCAOQHEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrFNO2/c12-8-9(13)6(4-11(14)1-2-11)3-7-10(8)16-5-15-7/h3H,1-2,4-5,14H2.
What are the key properties of 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine?
1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine has a molecular weight of 288.12 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)methyl]cyclopropan-1-amine is sourced from PubChem (CID 117464678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).