About 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine
5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine (PubChem CID 117465476) has the molecular formula C12H11F3N2O3
and a molecular weight of 288.23 g/mol. Its IUPAC name is 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine |
| PubChem CID | 117465476 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine |
| SMILES | COc1cc(-c2cc(N)no2)c(C(F)(F)F)cc1OC |
| InChI | InChI=1S/C12H11F3N2O3/c1-18-9-3-6(8-5-11(16)17-20-8)7(12(13,14)15)4-10(9)19-2/h3-5H,1-2H3,(H2,16,17) |
| InChIKey | PQIKOQRXRVFKLX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine?
The IUPAC name of 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine (CID 117465476) is 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine.
What is the SMILES notation for 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine?
The canonical SMILES for 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine is COc1cc(-c2cc(N)no2)c(C(F)(F)F)cc1OC.
What is the InChIKey of 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine?
The InChIKey is PQIKOQRXRVFKLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2O3/c1-18-9-3-6(8-5-11(16)17-20-8)7(12(13,14)15)4-10(9)19-2/h3-5H,1-2H3,(H2,16,17).
What are the key properties of 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine?
5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine has a molecular weight of 288.23 g/mol, XLogP of 2.96, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-3-amine is sourced from PubChem (CID 117465476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).