C17H14F2O2 — CID 117465606
1-[4-fluoro-3-(2-fluorophenyl)phenyl]cyclobutane-1-carboxylic acid (PubChem CID 117465606) has the molecular formula C17H14F2O2 and a molecular weight of 288.29 g/mol. Its IUPAC name is 1-[4-fluoro-3-(2-fluorophenyl)phenyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[4-fluoro-3-(2-fluorophenyl)phenyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117465606 |
| Molecular Formula | C17H14F2O2 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-[4-fluoro-3-(2-fluorophenyl)phenyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc(F)c(-c3ccccc3F)c2)CCC1 |
| InChI | InChI=1S/C17H14F2O2/c18-14-5-2-1-4-12(14)13-10-11(6-7-15(13)19)17(16(20)21)8-3-9-17/h1-2,4-7,10H,3,8-9H2,(H,20,21) |
| InChIKey | CHCMMEIGSNQDOQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |