C19H28O2 — CID 117466138
3-[3-(4-tert-butylcyclohexyl)phenyl]propanoic acid (PubChem CID 117466138) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 3-[3-(4-tert-butylcyclohexyl)phenyl]propanoic acid.
| Compound Name | 3-[3-(4-tert-butylcyclohexyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117466138 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 3-[3-(4-tert-butylcyclohexyl)phenyl]propanoic acid |
| SMILES | CC(C)(C)C1CCC(c2cccc(CCC(=O)O)c2)CC1 |
| InChI | InChI=1S/C19H28O2/c1-19(2,3)17-10-8-15(9-11-17)16-6-4-5-14(13-16)7-12-18(20)21/h4-6,13,15,17H,7-12H2,1-3H3,(H,20,21) |
| InChIKey | FPGCPODBTGUOKB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |