C12H15BrClN — CID 117466290
2-[(2-bromo-6-chlorophenyl)methyl]piperidine (PubChem CID 117466290) has the molecular formula C12H15BrClN and a molecular weight of 288.62 g/mol. Its IUPAC name is 2-[(2-bromo-6-chlorophenyl)methyl]piperidine.
| Compound Name | 2-[(2-bromo-6-chlorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 117466290 |
| Molecular Formula | C12H15BrClN |
| Molecular Weight | 288.62 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 2-[(2-bromo-6-chlorophenyl)methyl]piperidine |
| SMILES | Clc1cccc(Br)c1CC1CCCCN1 |
| InChI | InChI=1S/C12H15BrClN/c13-11-5-3-6-12(14)10(11)8-9-4-1-2-7-15-9/h3,5-6,9,15H,1-2,4,7-8H2 |
| InChIKey | SXJAUKYLIPOHQX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |