C14H19ClF2N2 — CID 117466506
1-[2-[3-chloro-2-(1,1-difluoroethyl)phenyl]ethyl]piperazine (PubChem CID 117466506) has the molecular formula C14H19ClF2N2 and a molecular weight of 288.77 g/mol. Its IUPAC name is 1-[2-[3-chloro-2-(1,1-difluoroethyl)phenyl]ethyl]piperazine.
| Compound Name | 1-[2-[3-chloro-2-(1,1-difluoroethyl)phenyl]ethyl]piperazine |
|---|---|
| PubChem CID | 117466506 |
| Molecular Formula | C14H19ClF2N2 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 1-[2-[3-chloro-2-(1,1-difluoroethyl)phenyl]ethyl]piperazine |
| SMILES | CC(F)(F)c1c(Cl)cccc1CCN1CCNCC1 |
| InChI | InChI=1S/C14H19ClF2N2/c1-14(16,17)13-11(3-2-4-12(13)15)5-8-19-9-6-18-7-10-19/h2-4,18H,5-10H2,1H3 |
| InChIKey | RKWOJQBAAKRCAY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |