C10H9BrO5 — CID 117466588
ethyl 2-(3-bromo-4,5-dihydroxyphenyl)-2-oxoacetate (PubChem CID 117466588) has the molecular formula C10H9BrO5 and a molecular weight of 289.08 g/mol. Its IUPAC name is ethyl 2-(3-bromo-4,5-dihydroxyphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(3-bromo-4,5-dihydroxyphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 117466588 |
| Molecular Formula | C10H9BrO5 |
| Molecular Weight | 289.08 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | ethyl 2-(3-bromo-4,5-dihydroxyphenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(O)c(O)c(Br)c1 |
| InChI | InChI=1S/C10H9BrO5/c1-2-16-10(15)8(13)5-3-6(11)9(14)7(12)4-5/h3-4,12,14H,2H2,1H3 |
| InChIKey | CRCCQDPAXFTSKO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.08 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|