C13H14Cl2O3 — CID 117466952
1-(2,5-dichloro-4-methoxyphenyl)cyclopentane-1-carboxylic acid (PubChem CID 117466952) has the molecular formula C13H14Cl2O3 and a molecular weight of 289.16 g/mol. Its IUPAC name is 1-(2,5-dichloro-4-methoxyphenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(2,5-dichloro-4-methoxyphenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117466952 |
| Molecular Formula | C13H14Cl2O3 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1-(2,5-dichloro-4-methoxyphenyl)cyclopentane-1-carboxylic acid |
| SMILES | COc1cc(Cl)c(C2(C(=O)O)CCCC2)cc1Cl |
| InChI | InChI=1S/C13H14Cl2O3/c1-18-11-7-9(14)8(6-10(11)15)13(12(16)17)4-2-3-5-13/h6-7H,2-5H2,1H3,(H,16,17) |
| InChIKey | ZUOVGTAAQKNVCN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |