C16H16ClNO2 — CID 117468018
[1-(4-chlorofuro[2,3-f][1]benzofuran-8-yl)cyclopentyl]methanamine (PubChem CID 117468018) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is [1-(4-chlorofuro[2,3-f][1]benzofuran-8-yl)cyclopentyl]methanamine.
| Compound Name | [1-(4-chlorofuro[2,3-f][1]benzofuran-8-yl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 117468018 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | [1-(4-chlorofuro[2,3-f][1]benzofuran-8-yl)cyclopentyl]methanamine |
| SMILES | NCC1(c2c3ccoc3c(Cl)c3ccoc23)CCCC1 |
| InChI | InChI=1S/C16H16ClNO2/c17-13-11-4-8-19-14(11)12(10-3-7-20-15(10)13)16(9-18)5-1-2-6-16/h3-4,7-8H,1-2,5-6,9,18H2 |
| InChIKey | XSLQRFMDMFZQIF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |