C11H16BrNOS — CID 117468734
2-amino-1-(3-bromo-4-propan-2-ylsulfanylphenyl)ethanol (PubChem CID 117468734) has the molecular formula C11H16BrNOS and a molecular weight of 290.23 g/mol. Its IUPAC name is 2-amino-1-(3-bromo-4-propan-2-ylsulfanylphenyl)ethanol.
| Compound Name | 2-amino-1-(3-bromo-4-propan-2-ylsulfanylphenyl)ethanol |
|---|---|
| PubChem CID | 117468734 |
| Molecular Formula | C11H16BrNOS |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 2-amino-1-(3-bromo-4-propan-2-ylsulfanylphenyl)ethanol |
| SMILES | CC(C)Sc1ccc(C(O)CN)cc1Br |
| InChI | InChI=1S/C11H16BrNOS/c1-7(2)15-11-4-3-8(5-9(11)12)10(14)6-13/h3-5,7,10,14H,6,13H2,1-2H3 |
| InChIKey | RHKDDARMILKZSJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |