C17H24O — CID 11746883
(2E,6E)-3,7-dimethyl-8-(3-methylphenyl)octa-2,6-dien-1-ol (PubChem CID 11746883) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (2E,6E)-3,7-dimethyl-8-(3-methylphenyl)octa-2,6-dien-1-ol.
| Compound Name | (2E,6E)-3,7-dimethyl-8-(3-methylphenyl)octa-2,6-dien-1-ol |
|---|---|
| PubChem CID | 11746883 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (2E,6E)-3,7-dimethyl-8-(3-methylphenyl)octa-2,6-dien-1-ol |
| SMILES | C/C(=C\CO)CC/C=C(\C)Cc1cccc(C)c1 |
| InChI | InChI=1S/C17H24O/c1-14(10-11-18)6-4-7-15(2)12-17-9-5-8-16(3)13-17/h5,7-10,13,18H,4,6,11-12H2,1-3H3/b14-10+,15-7+ |
| InChIKey | VZUFORHORPIJSR-SADFVUDUSA-N |
| XLogP | 4.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|