About 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid
5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid (PubChem CID 117468837) has the molecular formula C14H14N2O5
and a molecular weight of 290.28 g/mol. Its IUPAC name is 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid |
| PubChem CID | 117468837 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid |
| SMILES | COc1c(-c2cc(C(=O)O)nn2C)ccc2c1OCCO2 |
| InChI | InChI=1S/C14H14N2O5/c1-16-10(7-9(15-16)14(17)18)8-3-4-11-13(12(8)19-2)21-6-5-20-11/h3-4,7H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | JXXWDGOXWXALGY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid?
The IUPAC name of 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid (CID 117468837) is 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid.
What is the SMILES notation for 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid?
The canonical SMILES for 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid is COc1c(-c2cc(C(=O)O)nn2C)ccc2c1OCCO2.
What is the InChIKey of 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid?
The InChIKey is JXXWDGOXWXALGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O5/c1-16-10(7-9(15-16)14(17)18)8-3-4-11-13(12(8)19-2)21-6-5-20-11/h3-4,7H,5-6H2,1-2H3,(H,17,18).
What are the key properties of 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid?
5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid has a molecular weight of 290.28 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carboxylic acid is sourced from PubChem (CID 117468837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).