C12H15FO5S — CID 117468915
3-(2-fluoro-4-methoxy-3-methylsulfonylphenyl)-2-methylpropanoic acid (PubChem CID 117468915) has the molecular formula C12H15FO5S and a molecular weight of 290.31 g/mol. Its IUPAC name is 3-(2-fluoro-4-methoxy-3-methylsulfonylphenyl)-2-methylpropanoic acid.
| Compound Name | 3-(2-fluoro-4-methoxy-3-methylsulfonylphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117468915 |
| Molecular Formula | C12H15FO5S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3-(2-fluoro-4-methoxy-3-methylsulfonylphenyl)-2-methylpropanoic acid |
| SMILES | COc1ccc(CC(C)C(=O)O)c(F)c1S(C)(=O)=O |
| InChI | InChI=1S/C12H15FO5S/c1-7(12(14)15)6-8-4-5-9(18-2)11(10(8)13)19(3,16)17/h4-5,7H,6H2,1-3H3,(H,14,15) |
| InChIKey | ZAIMKYFWCMFORB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |