C16H27NO — CID 11747033
(6R,8R,11R)-2,2,11-trimethyl-8-prop-1-en-2-yl-1-azaspiro[5.5]undecan-4-one (PubChem CID 11747033) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (6R,8R,11R)-2,2,11-trimethyl-8-prop-1-en-2-yl-1-azaspiro[5.5]undecan-4-one.
| Compound Name | (6R,8R,11R)-2,2,11-trimethyl-8-prop-1-en-2-yl-1-azaspiro[5.5]undecan-4-one |
|---|---|
| PubChem CID | 11747033 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (6R,8R,11R)-2,2,11-trimethyl-8-prop-1-en-2-yl-1-azaspiro[5.5]undecan-4-one |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)[C@]2(CC(=O)CC(C)(C)N2)C1 |
| InChI | InChI=1S/C16H27NO/c1-11(2)13-7-6-12(3)16(8-13)10-14(18)9-15(4,5)17-16/h12-13,17H,1,6-10H2,2-5H3/t12-,13-,16-/m1/s1 |
| InChIKey | DGDAPTQXHBMKMV-XJKCOSOUSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|