C12H12ClF2NO3 — CID 117471128
5-(3-chloro-2,5-difluoro-6-methoxyphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117471128) has the molecular formula C12H12ClF2NO3 and a molecular weight of 291.68 g/mol. Its IUPAC name is 5-(3-chloro-2,5-difluoro-6-methoxyphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(3-chloro-2,5-difluoro-6-methoxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117471128 |
| Molecular Formula | C12H12ClF2NO3 |
| Molecular Weight | 291.68 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 5-(3-chloro-2,5-difluoro-6-methoxyphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1c(F)cc(Cl)c(F)c1C1CC(C(=O)O)CN1 |
| InChI | InChI=1S/C12H12ClF2NO3/c1-19-11-7(14)3-6(13)10(15)9(11)8-2-5(4-16-8)12(17)18/h3,5,8,16H,2,4H2,1H3,(H,17,18) |
| InChIKey | PTXJEQYWHWBDDL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.68 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|