C16H18ClNO2 — CID 117471217
4-chloro-1-(cyclopropylmethoxy)-2-(1-isocyanatocyclopentyl)benzene (PubChem CID 117471217) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is 4-chloro-1-(cyclopropylmethoxy)-2-(1-isocyanatocyclopentyl)benzene.
| Compound Name | 4-chloro-1-(cyclopropylmethoxy)-2-(1-isocyanatocyclopentyl)benzene |
|---|---|
| PubChem CID | 117471217 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-chloro-1-(cyclopropylmethoxy)-2-(1-isocyanatocyclopentyl)benzene |
| SMILES | O=C=NC1(c2cc(Cl)ccc2OCC2CC2)CCCC1 |
| InChI | InChI=1S/C16H18ClNO2/c17-13-5-6-15(20-10-12-3-4-12)14(9-13)16(18-11-19)7-1-2-8-16/h5-6,9,12H,1-4,7-8,10H2 |
| InChIKey | IKDOVEPCGSYGJV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|