C12H17FO3S2 — CID 117472304
2-(3-fluoro-4-methylsulfanyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol (PubChem CID 117472304) has the molecular formula C12H17FO3S2 and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-(3-fluoro-4-methylsulfanyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol.
| Compound Name | 2-(3-fluoro-4-methylsulfanyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 117472304 |
| Molecular Formula | C12H17FO3S2 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-(3-fluoro-4-methylsulfanyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol |
| SMILES | CSc1c(F)cc(C(C)(C)CO)cc1S(C)(=O)=O |
| InChI | InChI=1S/C12H17FO3S2/c1-12(2,7-14)8-5-9(13)11(17-3)10(6-8)18(4,15)16/h5-6,14H,7H2,1-4H3 |
| InChIKey | WWTAZHYXQUYATJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |