About 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione
1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione (PubChem CID 11747281) has the molecular formula C13H14N4O2
and a molecular weight of 258.28 g/mol. Its IUPAC name is 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione.
Molecular Properties
| Compound Name | 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione |
| PubChem CID | 11747281 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione |
| SMILES | CCCn1c(=O)c2c(nc3ccccn32)n(C)c1=O |
| InChI | InChI=1S/C13H14N4O2/c1-3-7-17-12(18)10-11(15(2)13(17)19)14-9-6-4-5-8-16(9)10/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | PUHQULGBXGXREB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione?
The IUPAC name of 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione (CID 11747281) is 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione.
What is the SMILES notation for 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione?
The canonical SMILES for 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione is CCCn1c(=O)c2c(nc3ccccn32)n(C)c1=O.
What is the InChIKey of 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione?
The InChIKey is PUHQULGBXGXREB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O2/c1-3-7-17-12(18)10-11(15(2)13(17)19)14-9-6-4-5-8-16(9)10/h4-6,8H,3,7H2,1-2H3.
What are the key properties of 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione?
1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione has a molecular weight of 258.28 g/mol, XLogP of 0.76, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-propylpurino[7,8-a]pyridine-2,4-dione is sourced from PubChem (CID 11747281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).