C11H13F2NO4S — CID 117473204
4-amino-4-(2,6-difluoro-3-methylsulfonylphenyl)butanoic acid (PubChem CID 117473204) has the molecular formula C11H13F2NO4S and a molecular weight of 293.29 g/mol. Its IUPAC name is 4-amino-4-(2,6-difluoro-3-methylsulfonylphenyl)butanoic acid.
| Compound Name | 4-amino-4-(2,6-difluoro-3-methylsulfonylphenyl)butanoic acid |
|---|---|
| PubChem CID | 117473204 |
| Molecular Formula | C11H13F2NO4S |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-amino-4-(2,6-difluoro-3-methylsulfonylphenyl)butanoic acid |
| SMILES | CS(=O)(=O)c1ccc(F)c(C(N)CCC(=O)O)c1F |
| InChI | InChI=1S/C11H13F2NO4S/c1-19(17,18)8-4-2-6(12)10(11(8)13)7(14)3-5-9(15)16/h2,4,7H,3,5,14H2,1H3,(H,15,16) |
| InChIKey | LUONADSLSMRJRQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |