C14H15NO4S — CID 117473332
3-[2-(1-isocyanatocyclobutyl)phenoxy]thietane 1,1-dioxide (PubChem CID 117473332) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 3-[2-(1-isocyanatocyclobutyl)phenoxy]thietane 1,1-dioxide.
| Compound Name | 3-[2-(1-isocyanatocyclobutyl)phenoxy]thietane 1,1-dioxide |
|---|---|
| PubChem CID | 117473332 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-[2-(1-isocyanatocyclobutyl)phenoxy]thietane 1,1-dioxide |
| SMILES | O=C=NC1(c2ccccc2OC2CS(=O)(=O)C2)CCC1 |
| InChI | InChI=1S/C14H15NO4S/c16-10-15-14(6-3-7-14)12-4-1-2-5-13(12)19-11-8-20(17,18)9-11/h1-2,4-5,11H,3,6-9H2 |
| InChIKey | YNNQQZZXOIKBJM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|