About (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate
(5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate (PubChem CID 11747431) has the molecular formula C15H18O2S
and a molecular weight of 262.37 g/mol. Its IUPAC name is (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate.
Molecular Properties
| Compound Name | (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate |
| PubChem CID | 11747431 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate |
| SMILES | CCC(=O)OC1=C(Cc2ccccc2)CSCC1 |
| InChI | InChI=1S/C15H18O2S/c1-2-15(16)17-14-8-9-18-11-13(14)10-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3 |
| InChIKey | VVVINUZQHRVHDC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate?
The IUPAC name of (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate (CID 11747431) is (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate.
What is the SMILES notation for (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate?
The canonical SMILES for (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate is CCC(=O)OC1=C(Cc2ccccc2)CSCC1.
What is the InChIKey of (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate?
The InChIKey is VVVINUZQHRVHDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2S/c1-2-15(16)17-14-8-9-18-11-13(14)10-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3.
What are the key properties of (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate?
(5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate has a molecular weight of 262.37 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-benzyl-3,6-dihydro-2H-thiopyran-4-yl) propanoate is sourced from PubChem (CID 11747431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).