About [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine
[5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine (PubChem CID 117475063) has the molecular formula C16H26N2O3
and a molecular weight of 294.40 g/mol. Its IUPAC name is [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine |
| PubChem CID | 117475063 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine |
| SMILES | CCOc1cc(C2CC(CN)CN2C)c(OC)cc1OC |
| InChI | InChI=1S/C16H26N2O3/c1-5-21-16-7-12(14(19-3)8-15(16)20-4)13-6-11(9-17)10-18(13)2/h7-8,11,13H,5-6,9-10,17H2,1-4H3 |
| InChIKey | AUMHPHNGMRWKMF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine?
The IUPAC name of [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine (CID 117475063) is [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine.
What is the SMILES notation for [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine?
The canonical SMILES for [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine is CCOc1cc(C2CC(CN)CN2C)c(OC)cc1OC.
What is the InChIKey of [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine?
The InChIKey is AUMHPHNGMRWKMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O3/c1-5-21-16-7-12(14(19-3)8-15(16)20-4)13-6-11(9-17)10-18(13)2/h7-8,11,13H,5-6,9-10,17H2,1-4H3.
What are the key properties of [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine?
[5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine has a molecular weight of 294.40 g/mol, XLogP of 2.05, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(5-ethoxy-2,4-dimethoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine is sourced from PubChem (CID 117475063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).