About 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine
5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine (PubChem CID 117475662) has the molecular formula C12H11BrN2O2
and a molecular weight of 295.14 g/mol. Its IUPAC name is 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine |
| PubChem CID | 117475662 |
| Molecular Formula | C12H11BrN2O2 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2ccc(OC3CC3)c(Br)c2)on1 |
| InChI | InChI=1S/C12H11BrN2O2/c13-9-5-7(11-6-12(14)15-17-11)1-4-10(9)16-8-2-3-8/h1,4-6,8H,2-3H2,(H2,14,15) |
| InChIKey | ZEYTWQHLYMHCEG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine?
The IUPAC name of 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine (CID 117475662) is 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine.
What is the SMILES notation for 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine?
The canonical SMILES for 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine is Nc1cc(-c2ccc(OC3CC3)c(Br)c2)on1.
What is the InChIKey of 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine?
The InChIKey is ZEYTWQHLYMHCEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrN2O2/c13-9-5-7(11-6-12(14)15-17-11)1-4-10(9)16-8-2-3-8/h1,4-6,8H,2-3H2,(H2,14,15).
What are the key properties of 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine?
5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine has a molecular weight of 295.14 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-bromo-4-cyclopropyloxyphenyl)-1,2-oxazol-3-amine is sourced from PubChem (CID 117475662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).