C15H22BrN — CID 117477395
[1-(3-bromo-4-pentan-3-ylphenyl)cyclopropyl]methanamine (PubChem CID 117477395) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is [1-(3-bromo-4-pentan-3-ylphenyl)cyclopropyl]methanamine.
| Compound Name | [1-(3-bromo-4-pentan-3-ylphenyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 117477395 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | [1-(3-bromo-4-pentan-3-ylphenyl)cyclopropyl]methanamine |
| SMILES | CCC(CC)c1ccc(C2(CN)CC2)cc1Br |
| InChI | InChI=1S/C15H22BrN/c1-3-11(4-2)13-6-5-12(9-14(13)16)15(10-17)7-8-15/h5-6,9,11H,3-4,7-8,10,17H2,1-2H3 |
| InChIKey | UBCAHBLYFPPLBD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |