C15H18O5 — CID 11747876
methyl (1S,2R,6R,7R)-3-acetyloxy-6-methoxytricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate (PubChem CID 11747876) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is methyl (1S,2R,6R,7R)-3-acetyloxy-6-methoxytricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate.
| Compound Name | methyl (1S,2R,6R,7R)-3-acetyloxy-6-methoxytricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
|---|---|
| PubChem CID | 11747876 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | methyl (1S,2R,6R,7R)-3-acetyloxy-6-methoxytricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
| SMILES | COC(=O)C1=C(OC(C)=O)[C@@H]2[C@@H]3C=C[C@@H](C3)[C@]2(OC)C1 |
| InChI | InChI=1S/C15H18O5/c1-8(16)20-13-11(14(17)18-2)7-15(19-3)10-5-4-9(6-10)12(13)15/h4-5,9-10,12H,6-7H2,1-3H3/t9-,10+,12+,15-/m1/s1 |
| InChIKey | DHMXIEQAUHNTHY-GOMXZESMSA-N |
| XLogP | 1.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|