methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate

C15H24O3Si — CID 11747964

IUPACmethyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate
SMILESCOC(=O)C(C)(C)C(O[Si](C)(C)C)c1ccccc1
InChIInChI=1S/C15H24O3Si/c1-15(2,14(16)17-3)13(18-19(4,5)6)12-10-8-7-9-11-12/h7-11,13H,1-6H3
InChIKeyZNYZRVKWDLXDEJ-UHFFFAOYSA-N
MW280.44 g/mol
LogP3.78
Rot. Bonds5

About methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate

methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate (PubChem CID 11747964) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate.

Molecular Properties

Compound Namemethyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate
PubChem CID11747964
Molecular FormulaC15H24O3Si
Molecular Weight280.44 g/mol
Exact Mass280.15
IUPAC Namemethyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate
SMILESCOC(=O)C(C)(C)C(O[Si](C)(C)C)c1ccccc1
InChIInChI=1S/C15H24O3Si/c1-15(2,14(16)17-3)13(18-19(4,5)6)12-10-8-7-9-11-12/h7-11,13H,1-6H3
InChIKeyZNYZRVKWDLXDEJ-UHFFFAOYSA-N
XLogP3.78
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.44
LogP ≤ 53.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate?
The IUPAC name of methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate (CID 11747964) is methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate.
What is the SMILES notation for methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate?
The canonical SMILES for methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate is COC(=O)C(C)(C)C(O[Si](C)(C)C)c1ccccc1.
What is the InChIKey of methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate?
The InChIKey is ZNYZRVKWDLXDEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3Si/c1-15(2,14(16)17-3)13(18-19(4,5)6)12-10-8-7-9-11-12/h7-11,13H,1-6H3.
What are the key properties of methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate?
methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate has a molecular weight of 280.44 g/mol, XLogP of 3.78, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethyl-3-phenyl-3-trimethylsilyloxypropanoate is sourced from PubChem (CID 11747964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).