About 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine
2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine (PubChem CID 117479948) has the molecular formula C13H16BrNO2
and a molecular weight of 298.18 g/mol. Its IUPAC name is 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine.
Molecular Properties
| Compound Name | 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine |
| PubChem CID | 117479948 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine |
| SMILES | CNCCc1cc2c(cc1Br)OC1(CCC1)O2 |
| InChI | InChI=1S/C13H16BrNO2/c1-15-6-3-9-7-11-12(8-10(9)14)17-13(16-11)4-2-5-13/h7-8,15H,2-6H2,1H3 |
| InChIKey | QCANWKQVDXSVOJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine?
The IUPAC name of 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine (CID 117479948) is 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine.
What is the SMILES notation for 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine?
The canonical SMILES for 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine is CNCCc1cc2c(cc1Br)OC1(CCC1)O2.
What is the InChIKey of 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine?
The InChIKey is QCANWKQVDXSVOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO2/c1-15-6-3-9-7-11-12(8-10(9)14)17-13(16-11)4-2-5-13/h7-8,15H,2-6H2,1H3.
What are the key properties of 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine?
2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine has a molecular weight of 298.18 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromospiro[1,3-benzodioxole-2,1'-cyclobutane]-5-yl)-N-methylethanamine is sourced from PubChem (CID 117479948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).